C9H19NO3S — CID 164645767
N-methoxy-N,4-dimethylcyclohexane-1-sulfonamide (PubChem CID 164645767) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is N-methoxy-N,4-dimethylcyclohexane-1-sulfonamide.
| Compound Name | N-methoxy-N,4-dimethylcyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 164645767 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-methoxy-N,4-dimethylcyclohexane-1-sulfonamide |
| SMILES | CON(C)S(=O)(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C9H19NO3S/c1-8-4-6-9(7-5-8)14(11,12)10(2)13-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | IYYUXQHMGRGWFR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|