C10H14FN3 — CID 164645816
2-fluoro-6-methyl-N-(2-methylcyclobutyl)pyrimidin-4-amine (PubChem CID 164645816) has the molecular formula C10H14FN3 and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-fluoro-6-methyl-N-(2-methylcyclobutyl)pyrimidin-4-amine.
| Compound Name | 2-fluoro-6-methyl-N-(2-methylcyclobutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 164645816 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 2-fluoro-6-methyl-N-(2-methylcyclobutyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCC2C)nc(F)n1 |
| InChI | InChI=1S/C10H14FN3/c1-6-3-4-8(6)13-9-5-7(2)12-10(11)14-9/h5-6,8H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | PXUCWMQKCVTPRX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |