C11H16FN3 — CID 164645870
2-fluoro-6-methyl-N-(2-propylcyclopropyl)pyrimidin-4-amine (PubChem CID 164645870) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-fluoro-6-methyl-N-(2-propylcyclopropyl)pyrimidin-4-amine.
| Compound Name | 2-fluoro-6-methyl-N-(2-propylcyclopropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 164645870 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-fluoro-6-methyl-N-(2-propylcyclopropyl)pyrimidin-4-amine |
| SMILES | CCCC1CC1Nc1cc(C)nc(F)n1 |
| InChI | InChI=1S/C11H16FN3/c1-3-4-8-6-9(8)14-10-5-7(2)13-11(12)15-10/h5,8-9H,3-4,6H2,1-2H3,(H,13,14,15) |
| InChIKey | ZXGPXIDEEFGJMI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |