C9H16N2O2 — CID 164646306
5-cyclopropyl-N-hydroxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 164646306) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-cyclopropyl-N-hydroxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-hydroxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 164646306 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-cyclopropyl-N-hydroxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CN(O)C(=O)C1CCC(C2CC2)N1 |
| InChI | InChI=1S/C9H16N2O2/c1-11(13)9(12)8-5-4-7(10-8)6-2-3-6/h6-8,10,13H,2-5H2,1H3 |
| InChIKey | GMSPQTLXNLPBHM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|