C10H19NO2S — CID 164646624
N-[(5,5-dimethyloxolan-2-yl)methyl]-2-sulfanylpropanamide (PubChem CID 164646624) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-[(5,5-dimethyloxolan-2-yl)methyl]-2-sulfanylpropanamide.
| Compound Name | N-[(5,5-dimethyloxolan-2-yl)methyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 164646624 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-[(5,5-dimethyloxolan-2-yl)methyl]-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)NCC1CCC(C)(C)O1 |
| InChI | InChI=1S/C10H19NO2S/c1-7(14)9(12)11-6-8-4-5-10(2,3)13-8/h7-8,14H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | WRKULZVPLIVECA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|