C7H9FN4O — CID 164648120
2-[(3-fluoropyrazin-2-yl)-methylamino]acetamide (PubChem CID 164648120) has the molecular formula C7H9FN4O and a molecular weight of 184.17 g/mol. Its IUPAC name is 2-[(3-fluoropyrazin-2-yl)-methylamino]acetamide.
| Compound Name | 2-[(3-fluoropyrazin-2-yl)-methylamino]acetamide |
|---|---|
| PubChem CID | 164648120 |
| Molecular Formula | C7H9FN4O |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-[(3-fluoropyrazin-2-yl)-methylamino]acetamide |
| SMILES | CN(CC(N)=O)c1nccnc1F |
| InChI | InChI=1S/C7H9FN4O/c1-12(4-5(9)13)7-6(8)10-2-3-11-7/h2-3H,4H2,1H3,(H2,9,13) |
| InChIKey | MIONMLNKSXSJCS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |