C8H9FN4O — CID 164648202
1-(3-fluoropyrazin-2-yl)azetidine-3-carboxamide (PubChem CID 164648202) has the molecular formula C8H9FN4O and a molecular weight of 196.19 g/mol. Its IUPAC name is 1-(3-fluoropyrazin-2-yl)azetidine-3-carboxamide.
| Compound Name | 1-(3-fluoropyrazin-2-yl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 164648202 |
| Molecular Formula | C8H9FN4O |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-(3-fluoropyrazin-2-yl)azetidine-3-carboxamide |
| SMILES | NC(=O)C1CN(c2nccnc2F)C1 |
| InChI | InChI=1S/C8H9FN4O/c9-6-8(12-2-1-11-6)13-3-5(4-13)7(10)14/h1-2,5H,3-4H2,(H2,10,14) |
| InChIKey | XYWGTKMDGBGNQR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |