C10H12BrNOS2 — CID 164648866
2-bromo-N-(4-methylthiolan-3-yl)thiophene-3-carboxamide (PubChem CID 164648866) has the molecular formula C10H12BrNOS2 and a molecular weight of 306.25 g/mol. Its IUPAC name is 2-bromo-N-(4-methylthiolan-3-yl)thiophene-3-carboxamide.
| Compound Name | 2-bromo-N-(4-methylthiolan-3-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 164648866 |
| Molecular Formula | C10H12BrNOS2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | 2-bromo-N-(4-methylthiolan-3-yl)thiophene-3-carboxamide |
| SMILES | CC1CSCC1NC(=O)c1ccsc1Br |
| InChI | InChI=1S/C10H12BrNOS2/c1-6-4-14-5-8(6)12-10(13)7-2-3-15-9(7)11/h2-3,6,8H,4-5H2,1H3,(H,12,13) |
| InChIKey | STAUPCAEXYZFDT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |