C8H9N3OS — CID 164649587
N-[2-(furan-3-yl)ethyl]-1,2,4-thiadiazol-5-amine (PubChem CID 164649587) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is N-[2-(furan-3-yl)ethyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[2-(furan-3-yl)ethyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 164649587 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | N-[2-(furan-3-yl)ethyl]-1,2,4-thiadiazol-5-amine |
| SMILES | c1nsc(NCCc2ccoc2)n1 |
| InChI | InChI=1S/C8H9N3OS/c1(7-2-4-12-5-7)3-9-8-10-6-11-13-8/h2,4-6H,1,3H2,(H,9,10,11) |
| InChIKey | JLIINNHVZSCKOC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |