C7H11ClN4O — CID 164649869
2-[(5-chloro-1-methylpyrazol-4-yl)amino]-N-methylacetamide (PubChem CID 164649869) has the molecular formula C7H11ClN4O and a molecular weight of 202.64 g/mol. Its IUPAC name is 2-[(5-chloro-1-methylpyrazol-4-yl)amino]-N-methylacetamide.
| Compound Name | 2-[(5-chloro-1-methylpyrazol-4-yl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 164649869 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-[(5-chloro-1-methylpyrazol-4-yl)amino]-N-methylacetamide |
| SMILES | CNC(=O)CNc1cnn(C)c1Cl |
| InChI | InChI=1S/C7H11ClN4O/c1-9-6(13)4-10-5-3-11-12(2)7(5)8/h3,10H,4H2,1-2H3,(H,9,13) |
| InChIKey | NGMSEUZHLIJRID-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |