C10H18ClNO — CID 164650053
1-[3-(chloromethyl)-3,4-dimethylpyrrolidin-1-yl]propan-1-one (PubChem CID 164650053) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-3,4-dimethylpyrrolidin-1-yl]propan-1-one.
| Compound Name | 1-[3-(chloromethyl)-3,4-dimethylpyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 164650053 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-[3-(chloromethyl)-3,4-dimethylpyrrolidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CC(C)C(C)(CCl)C1 |
| InChI | InChI=1S/C10H18ClNO/c1-4-9(13)12-5-8(2)10(3,6-11)7-12/h8H,4-7H2,1-3H3 |
| InChIKey | ZGRJDSJFNCGOTC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|