C8H12N2OS — CID 164653630
[(3S)-pyrrolidin-3-yl]-(1,2-thiazol-5-yl)methanol (PubChem CID 164653630) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is [(3S)-pyrrolidin-3-yl]-(1,2-thiazol-5-yl)methanol.
| Compound Name | [(3S)-pyrrolidin-3-yl]-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 164653630 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | [(3S)-pyrrolidin-3-yl]-(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccns1)[C@H]1CCNC1 |
| InChI | InChI=1S/C8H12N2OS/c11-8(6-1-3-9-5-6)7-2-4-10-12-7/h2,4,6,8-9,11H,1,3,5H2/t6-,8?/m0/s1 |
| InChIKey | ZQYGGUBAQVHBCM-UUEFVBAFSA-N |
| XLogP | 0.79 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |