C18H27BO3 — CID 164653939
2-(2-cyclopentyloxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 164653939) has the molecular formula C18H27BO3 and a molecular weight of 302.22 g/mol. Its IUPAC name is 2-(2-cyclopentyloxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2-cyclopentyloxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164653939 |
| Molecular Formula | C18H27BO3 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-(2-cyclopentyloxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C18H27BO3/c1-13-10-11-15(16(12-13)20-14-8-6-7-9-14)19-21-17(2,3)18(4,5)22-19/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | FLITYYKWAQGOCO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|