C10H17NO2 — CID 164654109
3,4-dihydro-2H-pyran-5-yl-[(3S)-pyrrolidin-3-yl]methanol (PubChem CID 164654109) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-5-yl-[(3S)-pyrrolidin-3-yl]methanol.
| Compound Name | 3,4-dihydro-2H-pyran-5-yl-[(3S)-pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 164654109 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3,4-dihydro-2H-pyran-5-yl-[(3S)-pyrrolidin-3-yl]methanol |
| SMILES | OC(C1=COCCC1)[C@H]1CCNC1 |
| InChI | InChI=1S/C10H17NO2/c12-10(8-3-4-11-6-8)9-2-1-5-13-7-9/h7-8,10-12H,1-6H2/t8-,10?/m0/s1 |
| InChIKey | KOMZCUAKRWTOHJ-PEHGTWAWSA-N |
| XLogP | 0.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |