C8H13BrN4O — CID 164654571
(5-bromo-3-methyltriazol-4-yl)-[(3S)-pyrrolidin-3-yl]methanol (PubChem CID 164654571) has the molecular formula C8H13BrN4O and a molecular weight of 261.12 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-[(3S)-pyrrolidin-3-yl]methanol.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-[(3S)-pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 164654571 |
| Molecular Formula | C8H13BrN4O |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-[(3S)-pyrrolidin-3-yl]methanol |
| SMILES | Cn1nnc(Br)c1C(O)[C@H]1CCNC1 |
| InChI | InChI=1S/C8H13BrN4O/c1-13-6(8(9)11-12-13)7(14)5-2-3-10-4-5/h5,7,10,14H,2-4H2,1H3/t5-,7?/m0/s1 |
| InChIKey | DDBQMHOKKONTTE-DSEUIKHZSA-N |
| XLogP | 0.22 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |