C8H12BrFN4 — CID 106640206
4-bromo-5-[fluoro(pyrrolidin-2-yl)methyl]-1-methyltriazole (PubChem CID 106640206) has the molecular formula C8H12BrFN4 and a molecular weight of 263.11 g/mol. Its IUPAC name is 4-bromo-5-[fluoro(pyrrolidin-2-yl)methyl]-1-methyltriazole.
| Compound Name | 4-bromo-5-[fluoro(pyrrolidin-2-yl)methyl]-1-methyltriazole |
|---|---|
| PubChem CID | 106640206 |
| Molecular Formula | C8H12BrFN4 |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 4-bromo-5-[fluoro(pyrrolidin-2-yl)methyl]-1-methyltriazole |
| SMILES | Cn1nnc(Br)c1C(F)C1CCCN1 |
| InChI | InChI=1S/C8H12BrFN4/c1-14-7(8(9)12-13-14)6(10)5-3-2-4-11-5/h5-6,11H,2-4H2,1H3 |
| InChIKey | QIAYSEYTHYWSJG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |