C14H23BrN4 — CID 106464960
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-bromo-3-methyltriazol-4-yl)methanamine (PubChem CID 106464960) has the molecular formula C14H23BrN4 and a molecular weight of 327.27 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-bromo-3-methyltriazol-4-yl)methanamine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-bromo-3-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 106464960 |
| Molecular Formula | C14H23BrN4 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl-(5-bromo-3-methyltriazol-4-yl)methanamine |
| SMILES | Cn1nnc(Br)c1C(N)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C14H23BrN4/c1-19-13(14(15)17-18-19)12(16)11-7-6-9-4-2-3-5-10(9)8-11/h9-12H,2-8,16H2,1H3 |
| InChIKey | IMRPUAPNXFUUPS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |