C13H14FN3 — CID 164655114
N-benzyl-2-fluoro-N,5-dimethylpyrimidin-4-amine (PubChem CID 164655114) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is N-benzyl-2-fluoro-N,5-dimethylpyrimidin-4-amine.
| Compound Name | N-benzyl-2-fluoro-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 164655114 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-benzyl-2-fluoro-N,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1cnc(F)nc1N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H14FN3/c1-10-8-15-13(14)16-12(10)17(2)9-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3 |
| InChIKey | DJGZRJXPTHROQK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |