C17H27N3 — CID 145242073
N-benzyl-N,3-dimethylpyrazin-2-amine;ethane (PubChem CID 145242073) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-benzyl-N,3-dimethylpyrazin-2-amine;ethane.
| Compound Name | N-benzyl-N,3-dimethylpyrazin-2-amine;ethane |
|---|---|
| PubChem CID | 145242073 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-benzyl-N,3-dimethylpyrazin-2-amine;ethane |
| SMILES | CC.CC.Cc1nccnc1N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H15N3.2C2H6/c1-11-13(15-9-8-14-11)16(2)10-12-6-4-3-5-7-12;2*1-2/h3-9H,10H2,1-2H3;2*1-2H3 |
| InChIKey | KYLRTQCYMGOBDB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |