C10H18N2O — CID 164655495
7-ethyl-1,2-diazaspiro[4.5]decan-3-one (PubChem CID 164655495) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 7-ethyl-1,2-diazaspiro[4.5]decan-3-one.
| Compound Name | 7-ethyl-1,2-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 164655495 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 7-ethyl-1,2-diazaspiro[4.5]decan-3-one |
| SMILES | CCC1CCCC2(CC(=O)NN2)C1 |
| InChI | InChI=1S/C10H18N2O/c1-2-8-4-3-5-10(6-8)7-9(13)11-12-10/h8,12H,2-7H2,1H3,(H,11,13) |
| InChIKey | LHHFDYJPXKTUAB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |