C10H19N3 — CID 79509789
7-ethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79509789) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 7-ethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 7-ethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79509789 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 7-ethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CCC1CCCC2(CN=C(N)N2)C1 |
| InChI | InChI=1S/C10H19N3/c1-2-8-4-3-5-10(6-8)7-12-9(11)13-10/h8H,2-7H2,1H3,(H3,11,12,13) |
| InChIKey | FUVHSTVKOLBRQT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |