C11H21N3 — CID 79509479
7-ethyl-1-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79509479) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 7-ethyl-1-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 7-ethyl-1-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79509479 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 7-ethyl-1-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CCC1CCCC2(CN=C(N)N2C)C1 |
| InChI | InChI=1S/C11H21N3/c1-3-9-5-4-6-11(7-9)8-13-10(12)14(11)2/h9H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | MVYMOJPZSGHAPO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |