C8H16N4 — CID 79510718
1-methyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79510718) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-methyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 1-methyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79510718 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1-methyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CN1C(N)=NCC12CCNCC2 |
| InChI | InChI=1S/C8H16N4/c1-12-7(9)11-6-8(12)2-4-10-5-3-8/h10H,2-6H2,1H3,(H2,9,11) |
| InChIKey | OFRMZMCBUCFUQE-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |