About 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine
1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine (PubChem CID 79510132) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine.
Molecular Properties
| Compound Name | 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine |
| PubChem CID | 79510132 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine |
| SMILES | CC1CCCC2(CC1)CN=C(N)N2C |
| InChI | InChI=1S/C11H21N3/c1-9-4-3-6-11(7-5-9)8-13-10(12)14(11)2/h9H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | QPCQGZBUMDMREA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
The IUPAC name of 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine (CID 79510132) is 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine.
What is the SMILES notation for 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
The canonical SMILES for 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine is CC1CCCC2(CC1)CN=C(N)N2C.
What is the InChIKey of 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
The InChIKey is QPCQGZBUMDMREA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-9-4-3-6-11(7-5-9)8-13-10(12)14(11)2/h9H,3-8H2,1-2H3,(H2,12,13).
What are the key properties of 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine?
1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine has a molecular weight of 195.31 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethyl-1,3-diazaspiro[4.6]undec-2-en-2-amine is sourced from PubChem (CID 79510132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).