C15H20FN3 — CID 79521117
1-(2-fluorophenyl)-7-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79521117) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-7-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 1-(2-fluorophenyl)-7-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 79521117 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-(2-fluorophenyl)-7-methyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CC1CCCC2(CN=C(N)N2c2ccccc2F)C1 |
| InChI | InChI=1S/C15H20FN3/c1-11-5-4-8-15(9-11)10-18-14(17)19(15)13-7-3-2-6-12(13)16/h2-3,6-7,11H,4-5,8-10H2,1H3,(H2,17,18) |
| InChIKey | HRCXNHLWYJEGKC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |