C16H22FN3 — CID 79521444
1-(3-fluorophenyl)-8-methyl-1,3-diazaspiro[4.6]undec-2-en-2-amine (PubChem CID 79521444) has the molecular formula C16H22FN3 and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-8-methyl-1,3-diazaspiro[4.6]undec-2-en-2-amine.
| Compound Name | 1-(3-fluorophenyl)-8-methyl-1,3-diazaspiro[4.6]undec-2-en-2-amine |
|---|---|
| PubChem CID | 79521444 |
| Molecular Formula | C16H22FN3 |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 1-(3-fluorophenyl)-8-methyl-1,3-diazaspiro[4.6]undec-2-en-2-amine |
| SMILES | CC1CCCC2(CC1)CN=C(N)N2c1cccc(F)c1 |
| InChI | InChI=1S/C16H22FN3/c1-12-4-3-8-16(9-7-12)11-19-15(18)20(16)14-6-2-5-13(17)10-14/h2,5-6,10,12H,3-4,7-9,11H2,1H3,(H2,18,19) |
| InChIKey | QOIMSPCWAPPXAC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |