C18H27N3 — CID 79500137
8-ethyl-1-(3-methylphenyl)-1,3-diazaspiro[4.6]undec-2-en-2-amine (PubChem CID 79500137) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 8-ethyl-1-(3-methylphenyl)-1,3-diazaspiro[4.6]undec-2-en-2-amine.
| Compound Name | 8-ethyl-1-(3-methylphenyl)-1,3-diazaspiro[4.6]undec-2-en-2-amine |
|---|---|
| PubChem CID | 79500137 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 8-ethyl-1-(3-methylphenyl)-1,3-diazaspiro[4.6]undec-2-en-2-amine |
| SMILES | CCC1CCCC2(CC1)CN=C(N)N2c1cccc(C)c1 |
| InChI | InChI=1S/C18H27N3/c1-3-15-7-5-10-18(11-9-15)13-20-17(19)21(18)16-8-4-6-14(2)12-16/h4,6,8,12,15H,3,5,7,9-11,13H2,1-2H3,(H2,19,20) |
| InChIKey | NANSBFAYHAYUCW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |