About 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine
1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine (PubChem CID 79504838) has the molecular formula C16H25N3
and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine.
Molecular Properties
| Compound Name | 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine |
| PubChem CID | 79504838 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine |
| SMILES | CCCC1(CCC)CN=C(N)N1c1cccc(C)c1 |
| InChI | InChI=1S/C16H25N3/c1-4-9-16(10-5-2)12-18-15(17)19(16)14-8-6-7-13(3)11-14/h6-8,11H,4-5,9-10,12H2,1-3H3,(H2,17,18) |
| InChIKey | WURZJDFYZMKKKN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine?
The IUPAC name of 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine (CID 79504838) is 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine.
What is the SMILES notation for 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine?
The canonical SMILES for 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine is CCCC1(CCC)CN=C(N)N1c1cccc(C)c1.
What is the InChIKey of 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine?
The InChIKey is WURZJDFYZMKKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3/c1-4-9-16(10-5-2)12-18-15(17)19(16)14-8-6-7-13(3)11-14/h6-8,11H,4-5,9-10,12H2,1-3H3,(H2,17,18).
What are the key properties of 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine?
1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine has a molecular weight of 259.40 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylphenyl)-5,5-dipropyl-4H-imidazol-2-amine is sourced from PubChem (CID 79504838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).