C10H21N3 — CID 79510362
1,5-dimethyl-5-(3-methylbutyl)-4H-imidazol-2-amine (PubChem CID 79510362) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 1,5-dimethyl-5-(3-methylbutyl)-4H-imidazol-2-amine.
| Compound Name | 1,5-dimethyl-5-(3-methylbutyl)-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 79510362 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 1,5-dimethyl-5-(3-methylbutyl)-4H-imidazol-2-amine |
| SMILES | CC(C)CCC1(C)CN=C(N)N1C |
| InChI | InChI=1S/C10H21N3/c1-8(2)5-6-10(3)7-12-9(11)13(10)4/h8H,5-7H2,1-4H3,(H2,11,12) |
| InChIKey | LFYJCRZVYMSEGS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |