C8H15N3 — CID 79510678
9-methyl-1,3-diazaspiro[4.4]non-2-en-2-amine (PubChem CID 79510678) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 9-methyl-1,3-diazaspiro[4.4]non-2-en-2-amine.
| Compound Name | 9-methyl-1,3-diazaspiro[4.4]non-2-en-2-amine |
|---|---|
| PubChem CID | 79510678 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 9-methyl-1,3-diazaspiro[4.4]non-2-en-2-amine |
| SMILES | CC1CCCC12CN=C(N)N2 |
| InChI | InChI=1S/C8H15N3/c1-6-3-2-4-8(6)5-10-7(9)11-8/h6H,2-5H2,1H3,(H3,9,10,11) |
| InChIKey | JOFBVCICPQIWFI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |