C9H15Cl2NO — CID 164655973
[1-(3,3-dichloroprop-2-enyl)piperidin-4-yl]methanol (PubChem CID 164655973) has the molecular formula C9H15Cl2NO and a molecular weight of 224.13 g/mol. Its IUPAC name is [1-(3,3-dichloroprop-2-enyl)piperidin-4-yl]methanol.
| Compound Name | [1-(3,3-dichloroprop-2-enyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 164655973 |
| Molecular Formula | C9H15Cl2NO |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | [1-(3,3-dichloroprop-2-enyl)piperidin-4-yl]methanol |
| SMILES | OCC1CCN(CC=C(Cl)Cl)CC1 |
| InChI | InChI=1S/C9H15Cl2NO/c10-9(11)3-6-12-4-1-8(7-13)2-5-12/h3,8,13H,1-2,4-7H2 |
| InChIKey | CAWIHNHVRAMJKL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |