C7H12NO3- — CID 18454833
4-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 18454833) has the molecular formula C7H12NO3- and a molecular weight of 158.18 g/mol. Its IUPAC name is 4-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | 4-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18454833 |
| Molecular Formula | C7H12NO3- |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 4-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(CO)CC1 |
| InChI | InChI=1S/C7H13NO3/c9-5-6-1-3-8(4-2-6)7(10)11/h6,9H,1-5H2,(H,10,11)/p-1 |
| InChIKey | MSRIZBHRUSVALK-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |