C9H16Cl2N2 — CID 164655976
1-(3,3-dichloroprop-2-enyl)-2-methylpiperidin-3-amine (PubChem CID 164655976) has the molecular formula C9H16Cl2N2 and a molecular weight of 223.15 g/mol. Its IUPAC name is 1-(3,3-dichloroprop-2-enyl)-2-methylpiperidin-3-amine.
| Compound Name | 1-(3,3-dichloroprop-2-enyl)-2-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 164655976 |
| Molecular Formula | C9H16Cl2N2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-(3,3-dichloroprop-2-enyl)-2-methylpiperidin-3-amine |
| SMILES | CC1C(N)CCCN1CC=C(Cl)Cl |
| InChI | InChI=1S/C9H16Cl2N2/c1-7-8(12)3-2-5-13(7)6-4-9(10)11/h4,7-8H,2-3,5-6,12H2,1H3 |
| InChIKey | GGNLVJUWFXIUKB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |