C10H24N2Si — CID 164655621
(2R,3R)-2-methyl-1-(trimethylsilylmethyl)piperidin-3-amine (PubChem CID 164655621) has the molecular formula C10H24N2Si and a molecular weight of 200.40 g/mol. Its IUPAC name is (2R,3R)-2-methyl-1-(trimethylsilylmethyl)piperidin-3-amine.
| Compound Name | (2R,3R)-2-methyl-1-(trimethylsilylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 164655621 |
| Molecular Formula | C10H24N2Si |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | (2R,3R)-2-methyl-1-(trimethylsilylmethyl)piperidin-3-amine |
| SMILES | C[C@@H]1[C@H](N)CCCN1C[Si](C)(C)C |
| InChI | InChI=1S/C10H24N2Si/c1-9-10(11)6-5-7-12(9)8-13(2,3)4/h9-10H,5-8,11H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | HSTDCYKXQIAYHB-NXEZZACHSA-N |
| XLogP | 1.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|