C10H24ClNSi — CID 130628913
(2,3-dimethylpyrrolidin-1-yl)methyl-trimethylsilane;hydrochloride (PubChem CID 130628913) has the molecular formula C10H24ClNSi and a molecular weight of 221.85 g/mol. Its IUPAC name is (2,3-dimethylpyrrolidin-1-yl)methyl-trimethylsilane;hydrochloride.
| Compound Name | (2,3-dimethylpyrrolidin-1-yl)methyl-trimethylsilane;hydrochloride |
|---|---|
| PubChem CID | 130628913 |
| Molecular Formula | C10H24ClNSi |
| Molecular Weight | 221.85 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2,3-dimethylpyrrolidin-1-yl)methyl-trimethylsilane;hydrochloride |
| SMILES | CC1CCN(C[Si](C)(C)C)C1C.Cl |
| InChI | InChI=1S/C10H23NSi.ClH/c1-9-6-7-11(10(9)2)8-12(3,4)5;/h9-10H,6-8H2,1-5H3;1H |
| InChIKey | BONPDETYNCHOPN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|