C11H19ClN2 — CID 164656137
2-[(E)-but-2-enyl]-7-chloro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 164656137) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-7-chloro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[(E)-but-2-enyl]-7-chloro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 164656137 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-[(E)-but-2-enyl]-7-chloro-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C/C=C/CN1CCN2CC(Cl)CC2C1 |
| InChI | InChI=1S/C11H19ClN2/c1-2-3-4-13-5-6-14-8-10(12)7-11(14)9-13/h2-3,10-11H,4-9H2,1H3/b3-2+ |
| InChIKey | SXKHAEDERZGJIN-NSCUHMNNSA-N |
| XLogP | 1.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|