C10H15N3O — CID 164657308
3-amino-N-(2,5-dimethyl-3-pyridinyl)propanamide (PubChem CID 164657308) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-amino-N-(2,5-dimethyl-3-pyridinyl)propanamide.
| Compound Name | 3-amino-N-(2,5-dimethyl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 164657308 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-amino-N-(2,5-dimethyl-3-pyridinyl)propanamide |
| SMILES | Cc1cnc(C)c(NC(=O)CCN)c1 |
| InChI | InChI=1S/C10H15N3O/c1-7-5-9(8(2)12-6-7)13-10(14)3-4-11/h5-6H,3-4,11H2,1-2H3,(H,13,14) |
| InChIKey | GNJVAJBAWRACSU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |