About 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol
2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol (PubChem CID 164658402) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol |
| PubChem CID | 164658402 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol |
| SMILES | CC(N)C(O)C1=COCC1 |
| InChI | InChI=1S/C7H13NO2/c1-5(8)7(9)6-2-3-10-4-6/h4-5,7,9H,2-3,8H2,1H3 |
| InChIKey | SPMNGXVEEBOMTE-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol?
The IUPAC name of 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol (CID 164658402) is 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol.
What is the SMILES notation for 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol?
The canonical SMILES for 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol is CC(N)C(O)C1=COCC1.
What is the InChIKey of 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol?
The InChIKey is SPMNGXVEEBOMTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5(8)7(9)6-2-3-10-4-6/h4-5,7,9H,2-3,8H2,1H3.
What are the key properties of 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol?
2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol has a molecular weight of 143.19 g/mol, XLogP of -0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,3-dihydrofuran-4-yl)propan-1-ol is sourced from PubChem (CID 164658402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).