About (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol
(2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol (PubChem CID 164662086) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol.
Molecular Properties
| Compound Name | (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol |
| PubChem CID | 164662086 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol |
| SMILES | CN[C@@H](C)C(O)C1=COCC1 |
| InChI | InChI=1S/C8H15NO2/c1-6(9-2)8(10)7-3-4-11-5-7/h5-6,8-10H,3-4H2,1-2H3/t6-,8?/m0/s1 |
| InChIKey | NNQLAPAPKZJMAE-UUEFVBAFSA-N |
| XLogP | 0.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol?
The IUPAC name of (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol (CID 164662086) is (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol.
What is the SMILES notation for (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol?
The canonical SMILES for (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol is CN[C@@H](C)C(O)C1=COCC1.
What is the InChIKey of (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol?
The InChIKey is NNQLAPAPKZJMAE-UUEFVBAFSA-N. The full InChI is InChI=1S/C8H15NO2/c1-6(9-2)8(10)7-3-4-11-5-7/h5-6,8-10H,3-4H2,1-2H3/t6-,8?/m0/s1.
What are the key properties of (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol?
(2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol has a molecular weight of 157.21 g/mol, XLogP of 0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(2,3-dihydrofuran-4-yl)-2-(methylamino)propan-1-ol is sourced from PubChem (CID 164662086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).