About 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde
2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde (PubChem CID 164659814) has the molecular formula C9H12F2OS
and a molecular weight of 206.26 g/mol. Its IUPAC name is 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde |
| PubChem CID | 164659814 |
| Molecular Formula | C9H12F2OS |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde |
| SMILES | O=CC1(CC2CC2(F)F)CCCS1 |
| InChI | InChI=1S/C9H12F2OS/c10-9(11)5-7(9)4-8(6-12)2-1-3-13-8/h6-7H,1-5H2 |
| InChIKey | QSHRQFGPXVSZRB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde?
The IUPAC name of 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde (CID 164659814) is 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde.
What is the SMILES notation for 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde?
The canonical SMILES for 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde is O=CC1(CC2CC2(F)F)CCCS1.
What is the InChIKey of 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde?
The InChIKey is QSHRQFGPXVSZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2OS/c10-9(11)5-7(9)4-8(6-12)2-1-3-13-8/h6-7H,1-5H2.
What are the key properties of 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde?
2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde has a molecular weight of 206.26 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-difluorocyclopropyl)methyl]thiolane-2-carbaldehyde is sourced from PubChem (CID 164659814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).