C11H14N2O2 — CID 164660426
2-(2-aminoethyl)-1,3-dihydroisoindole-4-carboxylic acid (PubChem CID 164660426) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1,3-dihydroisoindole-4-carboxylic acid.
| Compound Name | 2-(2-aminoethyl)-1,3-dihydroisoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 164660426 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(2-aminoethyl)-1,3-dihydroisoindole-4-carboxylic acid |
| SMILES | NCCN1Cc2cccc(C(=O)O)c2C1 |
| InChI | InChI=1S/C11H14N2O2/c12-4-5-13-6-8-2-1-3-9(11(14)15)10(8)7-13/h1-3H,4-7,12H2,(H,14,15) |
| InChIKey | UHPJXTGDSJNTNY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |