C12H20N2 — CID 164660543
2-(cyclopent-3-en-1-ylmethyl)-2,5-diazabicyclo[2.2.2]octane (PubChem CID 164660543) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-(cyclopent-3-en-1-ylmethyl)-2,5-diazabicyclo[2.2.2]octane.
| Compound Name | 2-(cyclopent-3-en-1-ylmethyl)-2,5-diazabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 164660543 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-(cyclopent-3-en-1-ylmethyl)-2,5-diazabicyclo[2.2.2]octane |
| SMILES | C1=CCC(CN2CC3CCC2CN3)C1 |
| InChI | InChI=1S/C12H20N2/c1-2-4-10(3-1)8-14-9-11-5-6-12(14)7-13-11/h1-2,10-13H,3-9H2 |
| InChIKey | UBQLPHUGYLCCBU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|