C15H28N2 — CID 70355896
(3S)-3,5-dimethyl-1-[(1R)-1-(5-methylcyclohex-3-en-1-yl)ethyl]piperazine (PubChem CID 70355896) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (3S)-3,5-dimethyl-1-[(1R)-1-(5-methylcyclohex-3-en-1-yl)ethyl]piperazine.
| Compound Name | (3S)-3,5-dimethyl-1-[(1R)-1-(5-methylcyclohex-3-en-1-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 70355896 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (3S)-3,5-dimethyl-1-[(1R)-1-(5-methylcyclohex-3-en-1-yl)ethyl]piperazine |
| SMILES | CC1C=CCC([C@@H](C)N2CC(C)N[C@@H](C)C2)C1 |
| InChI | InChI=1S/C15H28N2/c1-11-6-5-7-15(8-11)14(4)17-9-12(2)16-13(3)10-17/h5-6,11-16H,7-10H2,1-4H3/t11?,12-,13?,14+,15?/m0/s1 |
| InChIKey | OWNWZBXIZDWFEB-VNECMYLUSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|