C17H31FN2 — CID 123207174
1-(5-fluoro-2-methylcyclohept-4-en-1-yl)-N-(2-piperidin-1-ylethyl)ethanamine (PubChem CID 123207174) has the molecular formula C17H31FN2 and a molecular weight of 282.45 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylcyclohept-4-en-1-yl)-N-(2-piperidin-1-ylethyl)ethanamine.
| Compound Name | 1-(5-fluoro-2-methylcyclohept-4-en-1-yl)-N-(2-piperidin-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 123207174 |
| Molecular Formula | C17H31FN2 |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.25 |
| IUPAC Name | 1-(5-fluoro-2-methylcyclohept-4-en-1-yl)-N-(2-piperidin-1-ylethyl)ethanamine |
| SMILES | CC1CC=C(F)CCC1C(C)NCCN1CCCCC1 |
| InChI | InChI=1S/C17H31FN2/c1-14-6-7-16(18)8-9-17(14)15(2)19-10-13-20-11-4-3-5-12-20/h7,14-15,17,19H,3-6,8-13H2,1-2H3 |
| InChIKey | GWWXEXZTQLGMSW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |