C27H47FN2 — CID 143036842
1-[(4Z,6Z)-7-ethenyl-9-fluoro-9-methyl-2-(1-methylcycloheptyl)deca-4,6-dienyl]-3-ethylpiperazine (PubChem CID 143036842) has the molecular formula C27H47FN2 and a molecular weight of 418.69 g/mol. Its IUPAC name is 1-[(4Z,6Z)-7-ethenyl-9-fluoro-9-methyl-2-(1-methylcycloheptyl)deca-4,6-dienyl]-3-ethylpiperazine.
| Compound Name | 1-[(4Z,6Z)-7-ethenyl-9-fluoro-9-methyl-2-(1-methylcycloheptyl)deca-4,6-dienyl]-3-ethylpiperazine |
|---|---|
| PubChem CID | 143036842 |
| Molecular Formula | C27H47FN2 |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.37 |
| IUPAC Name | 1-[(4Z,6Z)-7-ethenyl-9-fluoro-9-methyl-2-(1-methylcycloheptyl)deca-4,6-dienyl]-3-ethylpiperazine |
| SMILES | C=C/C(=C\C=C/CC(CN1CCNC(CC)C1)C1(C)CCCCCC1)CC(C)(C)F |
| InChI | InChI=1S/C27H47FN2/c1-6-23(20-26(3,4)28)14-10-11-15-24(27(5)16-12-8-9-13-17-27)21-30-19-18-29-25(7-2)22-30/h6,10-11,14,24-25,29H,1,7-9,12-13,15-22H2,2-5H3/b11-10-,23-14+ |
| InChIKey | WNKOFEIYPAQBAC-BFSIDHLHSA-N |
| XLogP | 6.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|