C21H30F2N2 — CID 166907265
1-[2-[2-[4-[(Z)-but-2-enyl]-5,6-difluorocyclohepta-1,3,5-trien-1-yl]cyclobutyl]ethyl]piperazine (PubChem CID 166907265) has the molecular formula C21H30F2N2 and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-[2-[2-[4-[(Z)-but-2-enyl]-5,6-difluorocyclohepta-1,3,5-trien-1-yl]cyclobutyl]ethyl]piperazine.
| Compound Name | 1-[2-[2-[4-[(Z)-but-2-enyl]-5,6-difluorocyclohepta-1,3,5-trien-1-yl]cyclobutyl]ethyl]piperazine |
|---|---|
| PubChem CID | 166907265 |
| Molecular Formula | C21H30F2N2 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1-[2-[2-[4-[(Z)-but-2-enyl]-5,6-difluorocyclohepta-1,3,5-trien-1-yl]cyclobutyl]ethyl]piperazine |
| SMILES | C/C=C\CC1=CC=C(C2CCC2CCN2CCNCC2)CC(F)=C1F |
| InChI | InChI=1S/C21H30F2N2/c1-2-3-4-17-5-6-18(15-20(22)21(17)23)19-8-7-16(19)9-12-25-13-10-24-11-14-25/h2-3,5-6,16,19,24H,4,7-15H2,1H3/b3-2- |
| InChIKey | QOIJKJCQBRVGQV-IHWYPQMZSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|