C26H36N2 — CID 143036769
1-[2-cyclohexyl-2-(7-ethyl-1H-heptalen-3-yl)ethyl]piperazine (PubChem CID 143036769) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 1-[2-cyclohexyl-2-(7-ethyl-1H-heptalen-3-yl)ethyl]piperazine.
| Compound Name | 1-[2-cyclohexyl-2-(7-ethyl-1H-heptalen-3-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 143036769 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 1-[2-cyclohexyl-2-(7-ethyl-1H-heptalen-3-yl)ethyl]piperazine |
| SMILES | CCC1=CC=C=C2CC=C(C(CN3CCNCC3)C3CCCCC3)C=CC2=C1 |
| InChI | InChI=1S/C26H36N2/c1-2-21-7-6-10-22-11-12-24(13-14-25(22)19-21)26(23-8-4-3-5-9-23)20-28-17-15-27-16-18-28/h6-7,12-14,19,23,26-27H,2-5,8-9,11,15-18,20H2,1H3 |
| InChIKey | KXILZIRJKVGHSK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |