C23H34N2 — CID 90179393
1-[cyclohexa-1,5-dien-1-yl-di(cyclohex-2-en-1-yl)methyl]piperazine (PubChem CID 90179393) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-[cyclohexa-1,5-dien-1-yl-di(cyclohex-2-en-1-yl)methyl]piperazine.
| Compound Name | 1-[cyclohexa-1,5-dien-1-yl-di(cyclohex-2-en-1-yl)methyl]piperazine |
|---|---|
| PubChem CID | 90179393 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 1-[cyclohexa-1,5-dien-1-yl-di(cyclohex-2-en-1-yl)methyl]piperazine |
| SMILES | C1=CC(C(C2C=CCCC2)(C2C=CCCC2)N2CCNCC2)=CCC1 |
| InChI | InChI=1S/C23H34N2/c1-4-10-20(11-5-1)23(21-12-6-2-7-13-21,22-14-8-3-9-15-22)25-18-16-24-17-19-25/h4,6,8,10-12,14,21-22,24H,1-3,5,7,9,13,15-19H2 |
| InChIKey | OQUPUTPRCYFLJJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|