C9H15N3S — CID 164660676
1,2-dimethyl-1-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 164660676) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 164660676 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1,2-dimethyl-1-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(\N)N(C)Cc1ccc(C)s1 |
| InChI | InChI=1S/C9H15N3S/c1-7-4-5-8(13-7)6-12(3)9(10)11-2/h4-5H,6H2,1-3H3,(H2,10,11) |
| InChIKey | KBRXPUIMTFVAJT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|