C9H16N2S2 — CID 164660868
1-(1,3-dithiolan-2-ylmethyl)piperidin-2-imine (PubChem CID 164660868) has the molecular formula C9H16N2S2 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-(1,3-dithiolan-2-ylmethyl)piperidin-2-imine.
| Compound Name | 1-(1,3-dithiolan-2-ylmethyl)piperidin-2-imine |
|---|---|
| PubChem CID | 164660868 |
| Molecular Formula | C9H16N2S2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(1,3-dithiolan-2-ylmethyl)piperidin-2-imine |
| SMILES | [H]/N=C1\CCCCN1CC1SCCS1 |
| InChI | InChI=1S/C9H16N2S2/c10-8-3-1-2-4-11(8)7-9-12-5-6-13-9/h9-10H,1-7H2/b10-8+ |
| InChIKey | ONFWGZLASDQSNL-CSKARUKUSA-N |
| XLogP | 2.26 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|